C28H35F2N4O9P — CID 66622646
[(2S,4R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-diethoxyphosphoryloxy-4-hydroxypentyl] N-(3-phenyl-1,2-oxazol-5-yl)carbamate (PubChem CID 66622646) has the molecular formula C28H35F2N4O9P and a molecular weight of 640.58 g/mol. Its IUPAC name is [(2S,4R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-diethoxyphosphoryloxy-4-hydroxypentyl] N-(3-phenyl-1,2-oxazol-5-yl)carbamate.
| Compound Name | [(2S,4R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-diethoxyphosphoryloxy-4-hydroxypentyl] N-(3-phenyl-1,2-oxazol-5-yl)carbamate |
|---|---|
| PubChem CID | 66622646 |
| Molecular Formula | C28H35F2N4O9P |
| Molecular Weight | 640.58 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | [(2S,4R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-diethoxyphosphoryloxy-4-hydroxypentyl] N-(3-phenyl-1,2-oxazol-5-yl)carbamate |
| SMILES | CCOP(=O)(OCC)OC[C@H](O)C[C@@H](COC(=O)Nc1cc(-c2ccccc2)no1)N(NCc1cccc(F)c1F)C(C)=O |
| InChI | InChI=1S/C28H35F2N4O9P/c1-4-40-44(38,41-5-2)42-18-23(36)14-22(34(19(3)35)31-16-21-12-9-13-24(29)27(21)30)17-39-28(37)32-26-15-25(33-43-26)20-10-7-6-8-11-20/h6-13,15,22-23,31,36H,4-5,14,16-18H2,1-3H3,(H,32,37)/t22-,23+/m0/s1 |
| InChIKey | HMWRYZOTOFBLFD-XZOQPEGZSA-N |
| XLogP | 5.04 |
| TPSA | 161.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|