C30H39F2N4O10P2+ — CID 87078843
[4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-2-diethoxyphosphoryloxy-5-[(5-phenyl-1,2-oxazol-3-yl)carbamoyloxy]pentyl]-ethoxy-oxophosphanium (PubChem CID 87078843) has the molecular formula C30H39F2N4O10P2+ and a molecular weight of 715.60 g/mol. Its IUPAC name is [4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-2-diethoxyphosphoryloxy-5-[(5-phenyl-1,2-oxazol-3-yl)carbamoyloxy]pentyl]-ethoxy-oxophosphanium.
| Compound Name | [4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-2-diethoxyphosphoryloxy-5-[(5-phenyl-1,2-oxazol-3-yl)carbamoyloxy]pentyl]-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 87078843 |
| Molecular Formula | C30H39F2N4O10P2+ |
| Molecular Weight | 715.60 g/mol |
| Exact Mass | 715.21 |
| IUPAC Name | [4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-2-diethoxyphosphoryloxy-5-[(5-phenyl-1,2-oxazol-3-yl)carbamoyloxy]pentyl]-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)CC(CC(COC(=O)Nc1cc(-c2ccccc2)on1)N(NCc1cccc(F)c1F)C(C)=O)OP(=O)(OCC)OCC |
| InChI | InChI=1S/C30H38F2N4O10P2/c1-5-42-47(39)20-25(46-48(40,43-6-2)44-7-3)16-24(36(21(4)37)33-18-23-14-11-15-26(31)29(23)32)19-41-30(38)34-28-17-27(45-35-28)22-12-9-8-10-13-22/h8-15,17,24-25,33H,5-7,16,18-20H2,1-4H3/p+1 |
| InChIKey | XCXFRMIIKBGFGI-UHFFFAOYSA-O |
| XLogP | 6.83 |
| TPSA | 167.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|