C36H29BrN4O4 — CID 141235016
5-[4-(bromomethoxy)phenyl]-10-(2,3,4-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 141235016) has the molecular formula C36H29BrN4O4 and a molecular weight of 661.56 g/mol. Its IUPAC name is 5-[4-(bromomethoxy)phenyl]-10-(2,3,4-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-[4-(bromomethoxy)phenyl]-10-(2,3,4-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 141235016 |
| Molecular Formula | C36H29BrN4O4 |
| Molecular Weight | 661.56 g/mol |
| Exact Mass | 660.14 |
| IUPAC Name | 5-[4-(bromomethoxy)phenyl]-10-(2,3,4-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OCBr)cc4)c4ccc(cc5nc(cc6ccc2[nH]6)C=C5)[nH]4)C=C3)c(OC)c1OC |
| InChI | InChI=1S/C36H29BrN4O4/c1-42-32-17-12-27(35(43-2)36(32)44-3)34-30-14-9-25(40-30)19-23-7-6-22(38-23)18-24-8-13-28(39-24)33(29-15-16-31(34)41-29)21-4-10-26(11-5-21)45-20-37/h4-19,39-40H,20H2,1-3H3/b22-18-,23-19-,24-18-,25-19-,33-28-,33-29-,34-30-,34-31- |
| InChIKey | QMCBXXLCNVINAK-RSXOJHSISA-N |
| XLogP | 8.75 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.56 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|