C6H12F6N2O4S2 — CID 141239021
trifluoromethanesulfinate;trimethyl-[(trifluoromethylsulfonylamino)methyl]azanium (PubChem CID 141239021) has the molecular formula C6H12F6N2O4S2 and a molecular weight of 354.29 g/mol. Its IUPAC name is trifluoromethanesulfinate;trimethyl-[(trifluoromethylsulfonylamino)methyl]azanium.
| Compound Name | trifluoromethanesulfinate;trimethyl-[(trifluoromethylsulfonylamino)methyl]azanium |
|---|---|
| PubChem CID | 141239021 |
| Molecular Formula | C6H12F6N2O4S2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | trifluoromethanesulfinate;trimethyl-[(trifluoromethylsulfonylamino)methyl]azanium |
| SMILES | C[N+](C)(C)CNS(=O)(=O)C(F)(F)F.O=S([O-])C(F)(F)F |
| InChI | InChI=1S/C5H12F3N2O2S.CHF3O2S/c1-10(2,3)4-9-13(11,12)5(6,7)8;2-1(3,4)7(5)6/h9H,4H2,1-3H3;(H,5,6)/q+1;/p-1 |
| InChIKey | JPXPEDNXIQECII-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|