C4H11F3N2O5S2 — CID 139431093
N-(trifluoromethylsulfonyl)sulfamate;trimethylazanium (PubChem CID 139431093) has the molecular formula C4H11F3N2O5S2 and a molecular weight of 288.27 g/mol. Its IUPAC name is N-(trifluoromethylsulfonyl)sulfamate;trimethylazanium.
| Compound Name | N-(trifluoromethylsulfonyl)sulfamate;trimethylazanium |
|---|---|
| PubChem CID | 139431093 |
| Molecular Formula | C4H11F3N2O5S2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | N-(trifluoromethylsulfonyl)sulfamate;trimethylazanium |
| SMILES | C[NH+](C)C.O=S(=O)([O-])NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C3H9N.CH2F3NO5S2/c1-4(2)3;2-1(3,4)11(6,7)5-12(8,9)10/h1-3H3;5H,(H,8,9,10) |
| InChIKey | AKKOEUUXMPLKIE-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|