C6H8F10N2O4S2 — CID 141392550
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;dimethylazanium (PubChem CID 141392550) has the molecular formula C6H8F10N2O4S2 and a molecular weight of 426.25 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;dimethylazanium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;dimethylazanium |
|---|---|
| PubChem CID | 141392550 |
| Molecular Formula | C6H8F10N2O4S2 |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;dimethylazanium |
| SMILES | C[NH2+]C.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F10NO4S2.C2H7N/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;1-3-2/h;3H,1-2H3/q-1;/p+1 |
| InChIKey | WBLMTTZVWXBPES-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|