C7H10F10N2O4S2 — CID 141425026
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;trimethylazanium (PubChem CID 141425026) has the molecular formula C7H10F10N2O4S2 and a molecular weight of 440.28 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;trimethylazanium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;trimethylazanium |
|---|---|
| PubChem CID | 141425026 |
| Molecular Formula | C7H10F10N2O4S2 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;trimethylazanium |
| SMILES | C[NH+](C)C.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F10NO4S2.C3H9N/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;1-4(2)3/h;1-3H3/q-1;/p+1 |
| InChIKey | NZQDHTBINYJEPH-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|