C19H30O3 — CID 141244280
3-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one (PubChem CID 141244280) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one.
| Compound Name | 3-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one |
|---|---|
| PubChem CID | 141244280 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 3-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one |
| SMILES | C=C(OC(C)(C(C)C)C12CC3CC(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C19H30O3/c1-12(2)17(5,22-14(4)13(3)20)18-7-15-6-16(8-18)10-19(21,9-15)11-18/h12,15-16,21H,4,6-11H2,1-3,5H3 |
| InChIKey | FPFFFZNUTVQOJX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|