C18H28O4 — CID 141244279
3-[2-(3,5-dihydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one (PubChem CID 141244279) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-[2-(3,5-dihydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one.
| Compound Name | 3-[2-(3,5-dihydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141244279 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-[2-(3,5-dihydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one |
| SMILES | C=C(OC(C)(CC)C12CC3CC(O)(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C18H28O4/c1-5-15(4,22-13(3)12(2)19)16-6-14-7-17(20,9-16)11-18(21,8-14)10-16/h14,20-21H,3,5-11H2,1-2,4H3 |
| InChIKey | CBUAPONNALFMDL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|