C16H24O3 — CID 141244273
3-[(3-hydroxy-5,7-dimethyl-1-adamantyl)oxy]but-3-en-2-one (PubChem CID 141244273) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 3-[(3-hydroxy-5,7-dimethyl-1-adamantyl)oxy]but-3-en-2-one.
| Compound Name | 3-[(3-hydroxy-5,7-dimethyl-1-adamantyl)oxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141244273 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3-[(3-hydroxy-5,7-dimethyl-1-adamantyl)oxy]but-3-en-2-one |
| SMILES | C=C(OC12CC3(C)CC(C)(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C16H24O3/c1-11(17)12(2)19-16-8-13(3)5-14(4,9-16)7-15(18,6-13)10-16/h18H,2,5-10H2,1,3-4H3 |
| InChIKey | XGPMIKCTKNXUJH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|