C14H20O5 — CID 141244284
3-[(3,5,7-trihydroxy-1-adamantyl)oxy]but-3-en-2-one (PubChem CID 141244284) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[(3,5,7-trihydroxy-1-adamantyl)oxy]but-3-en-2-one.
| Compound Name | 3-[(3,5,7-trihydroxy-1-adamantyl)oxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141244284 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-[(3,5,7-trihydroxy-1-adamantyl)oxy]but-3-en-2-one |
| SMILES | C=C(OC12CC3(O)CC(O)(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C14H20O5/c1-9(15)10(2)19-14-6-11(16)3-12(17,7-14)5-13(18,4-11)8-14/h16-18H,2-8H2,1H3 |
| InChIKey | KKNNOEVFHBEEEA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|