C14H20O4 — CID 141073518
3-[(3,5-dihydroxy-1-adamantyl)oxy]but-3-en-2-one (PubChem CID 141073518) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-[(3,5-dihydroxy-1-adamantyl)oxy]but-3-en-2-one.
| Compound Name | 3-[(3,5-dihydroxy-1-adamantyl)oxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141073518 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-[(3,5-dihydroxy-1-adamantyl)oxy]but-3-en-2-one |
| SMILES | C=C(OC12CC3CC(O)(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C14H20O4/c1-9(15)10(2)18-14-5-11-3-12(16,7-14)6-13(17,4-11)8-14/h11,16-17H,2-8H2,1H3 |
| InChIKey | TUXMYHHNTIGRAD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|