C19H30O4 — CID 141244281
3-[2-(3,5-dihydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one (PubChem CID 141244281) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-[2-(3,5-dihydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one.
| Compound Name | 3-[2-(3,5-dihydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one |
|---|---|
| PubChem CID | 141244281 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 3-[2-(3,5-dihydroxy-1-adamantyl)-3-methylbutan-2-yl]oxybut-3-en-2-one |
| SMILES | C=C(OC(C)(C(C)C)C12CC3CC(O)(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C19H30O4/c1-12(2)16(5,23-14(4)13(3)20)17-6-15-7-18(21,9-17)11-19(22,8-15)10-17/h12,15,21-22H,4,6-11H2,1-3,5H3 |
| InChIKey | KUQFZBLKULOCDP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|