C18H28O3 — CID 141244297
3-[2-(3-hydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one (PubChem CID 141244297) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-[2-(3-hydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one.
| Compound Name | 3-[2-(3-hydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141244297 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 3-[2-(3-hydroxy-1-adamantyl)butan-2-yloxy]but-3-en-2-one |
| SMILES | C=C(OC(C)(CC)C12CC3CC(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C18H28O3/c1-5-16(4,21-13(3)12(2)19)17-7-14-6-15(8-17)10-18(20,9-14)11-17/h14-15,20H,3,5-11H2,1-2,4H3 |
| InChIKey | QRPCZGRDEQTZHX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|