C17H26O4 — CID 141244294
3-[2-(3,5-dihydroxy-1-adamantyl)propan-2-yloxy]but-3-en-2-one (PubChem CID 141244294) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-[2-(3,5-dihydroxy-1-adamantyl)propan-2-yloxy]but-3-en-2-one.
| Compound Name | 3-[2-(3,5-dihydroxy-1-adamantyl)propan-2-yloxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141244294 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-[2-(3,5-dihydroxy-1-adamantyl)propan-2-yloxy]but-3-en-2-one |
| SMILES | C=C(OC(C)(C)C12CC3CC(O)(CC(O)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C17H26O4/c1-11(18)12(2)21-14(3,4)15-5-13-6-16(19,8-15)10-17(20,7-13)9-15/h13,19-20H,2,5-10H2,1,3-4H3 |
| InChIKey | VCKBKIZWMBCWEP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|