C11H17N3O3 — CID 141248890
N-[1-[[(E)-ethylidenecarbamoyl]amino]ethyl]-4-methyl-3-oxopent-4-enamide (PubChem CID 141248890) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[1-[[(E)-ethylidenecarbamoyl]amino]ethyl]-4-methyl-3-oxopent-4-enamide.
| Compound Name | N-[1-[[(E)-ethylidenecarbamoyl]amino]ethyl]-4-methyl-3-oxopent-4-enamide |
|---|---|
| PubChem CID | 141248890 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-[1-[[(E)-ethylidenecarbamoyl]amino]ethyl]-4-methyl-3-oxopent-4-enamide |
| SMILES | C=C(C)C(=O)CC(=O)NC(C)NC(=O)/N=C/C |
| InChI | InChI=1S/C11H17N3O3/c1-5-12-11(17)14-8(4)13-10(16)6-9(15)7(2)3/h5,8H,2,6H2,1,3-4H3,(H,13,16)(H,14,17)/b12-5+ |
| InChIKey | XVMVKUKFUMVNCM-LFYBBSHMSA-N |
| XLogP | 0.78 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|