About 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate
6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate (PubChem CID 141252987) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate |
| PubChem CID | 141252987 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate |
| SMILES | CCOC(C(=O)OCCCCCCO)=C(C)C |
| InChI | InChI=1S/C13H24O4/c1-4-16-12(11(2)3)13(15)17-10-8-6-5-7-9-14/h14H,4-10H2,1-3H3 |
| InChIKey | DAWUKFBFJAMBOH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate?
The IUPAC name of 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate (CID 141252987) is 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate.
What is the SMILES notation for 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate?
The canonical SMILES for 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate is CCOC(C(=O)OCCCCCCO)=C(C)C.
What is the InChIKey of 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate?
The InChIKey is DAWUKFBFJAMBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-4-16-12(11(2)3)13(15)17-10-8-6-5-7-9-14/h14H,4-10H2,1-3H3.
What are the key properties of 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate?
6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate has a molecular weight of 244.33 g/mol, XLogP of 2.41, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl 2-ethoxy-3-methylbut-2-enoate is sourced from PubChem (CID 141252987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).