C22H22ClFN4O3 — CID 141254200
N-(4-chloro-3-fluorophenyl)-6-methoxy-7-(1-methylpiperidin-3-yl)-3-nitroquinolin-4-amine (PubChem CID 141254200) has the molecular formula C22H22ClFN4O3 and a molecular weight of 444.89 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-6-methoxy-7-(1-methylpiperidin-3-yl)-3-nitroquinolin-4-amine.
| Compound Name | N-(4-chloro-3-fluorophenyl)-6-methoxy-7-(1-methylpiperidin-3-yl)-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 141254200 |
| Molecular Formula | C22H22ClFN4O3 |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-6-methoxy-7-(1-methylpiperidin-3-yl)-3-nitroquinolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(F)c3)c([N+](=O)[O-])cnc2cc1C1CCCN(C)C1 |
| InChI | InChI=1S/C22H22ClFN4O3/c1-27-7-3-4-13(12-27)15-9-19-16(10-21(15)31-2)22(20(11-25-19)28(29)30)26-14-5-6-17(23)18(24)8-14/h5-6,8-11,13H,3-4,7,12H2,1-2H3,(H,25,26) |
| InChIKey | CJIGKPPHVCZDIV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|