C21H30N4 — CID 141258488
N',N'-diethyl-N-methyl-N-(9-methylpyrido[3,4-b]indol-1-yl)butane-1,4-diamine (PubChem CID 141258488) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is N',N'-diethyl-N-methyl-N-(9-methylpyrido[3,4-b]indol-1-yl)butane-1,4-diamine.
| Compound Name | N',N'-diethyl-N-methyl-N-(9-methylpyrido[3,4-b]indol-1-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 141258488 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | N',N'-diethyl-N-methyl-N-(9-methylpyrido[3,4-b]indol-1-yl)butane-1,4-diamine |
| SMILES | CCN(CC)CCCCN(C)c1nccc2c3ccccc3n(C)c12 |
| InChI | InChI=1S/C21H30N4/c1-5-25(6-2)16-10-9-15-23(3)21-20-18(13-14-22-21)17-11-7-8-12-19(17)24(20)4/h7-8,11-14H,5-6,9-10,15-16H2,1-4H3 |
| InChIKey | OOCJHCQYMPSMAF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|