C15H15BrFN5O4S — CID 141259636
2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,4-dihydropyrazol-3-yl]-1H-pyrazol-5-yl]amino]ethyl methanesulfonate (PubChem CID 141259636) has the molecular formula C15H15BrFN5O4S and a molecular weight of 460.29 g/mol. Its IUPAC name is 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,4-dihydropyrazol-3-yl]-1H-pyrazol-5-yl]amino]ethyl methanesulfonate.
| Compound Name | 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,4-dihydropyrazol-3-yl]-1H-pyrazol-5-yl]amino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 141259636 |
| Molecular Formula | C15H15BrFN5O4S |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,4-dihydropyrazol-3-yl]-1H-pyrazol-5-yl]amino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCNc1[nH]ncc1C1=NNC(=O)C1c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H15BrFN5O4S/c1-27(24,25)26-5-4-18-14-9(7-19-21-14)13-12(15(23)22-20-13)8-2-3-11(17)10(16)6-8/h2-3,6-7,12H,4-5H2,1H3,(H,22,23)(H2,18,19,21) |
| InChIKey | BREQLBLSMQFMHD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|