C25H22O6 — CID 141261093
2-(4-methoxyphenyl)-3-(2,3,4-trimethoxyphenyl)-1-benzofuran-5-carbaldehyde (PubChem CID 141261093) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-(2,3,4-trimethoxyphenyl)-1-benzofuran-5-carbaldehyde.
| Compound Name | 2-(4-methoxyphenyl)-3-(2,3,4-trimethoxyphenyl)-1-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 141261093 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-(2,3,4-trimethoxyphenyl)-1-benzofuran-5-carbaldehyde |
| SMILES | COc1ccc(-c2oc3ccc(C=O)cc3c2-c2ccc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C25H22O6/c1-27-17-8-6-16(7-9-17)23-22(19-13-15(14-26)5-11-20(19)31-23)18-10-12-21(28-2)25(30-4)24(18)29-3/h5-14H,1-4H3 |
| InChIKey | QGGRTFITRCLAAT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|