C21H18F3N3O5S — CID 141263120
[(3S)-5-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate (PubChem CID 141263120) has the molecular formula C21H18F3N3O5S and a molecular weight of 481.45 g/mol. Its IUPAC name is [(3S)-5-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate.
| Compound Name | [(3S)-5-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141263120 |
| Molecular Formula | C21H18F3N3O5S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [(3S)-5-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(O)C#Cc1cnc2c(c1)[C@]1(C=C(N)NC1)c1cc(OS(=O)(=O)C(F)(F)F)ccc1O2 |
| InChI | InChI=1S/C21H18F3N3O5S/c1-19(2,28)6-5-12-7-15-18(26-10-12)31-16-4-3-13(32-33(29,30)21(22,23)24)8-14(16)20(15)9-17(25)27-11-20/h3-4,7-10,27-28H,11,25H2,1-2H3/t20-/m0/s1 |
| InChIKey | HYXZBUPYFLHJAQ-FQEVSTJZSA-N |
| XLogP | 2.23 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|