C28H55NO — CID 141277198
2-methyl-N,3-dioctylundec-2-enamide (PubChem CID 141277198) has the molecular formula C28H55NO and a molecular weight of 421.75 g/mol. Its IUPAC name is 2-methyl-N,3-dioctylundec-2-enamide.
| Compound Name | 2-methyl-N,3-dioctylundec-2-enamide |
|---|---|
| PubChem CID | 141277198 |
| Molecular Formula | C28H55NO |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.43 |
| IUPAC Name | 2-methyl-N,3-dioctylundec-2-enamide |
| SMILES | CCCCCCCCNC(=O)C(C)=C(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C28H55NO/c1-5-8-11-14-17-20-23-27(24-21-18-15-12-9-6-2)26(4)28(30)29-25-22-19-16-13-10-7-3/h5-25H2,1-4H3,(H,29,30) |
| InChIKey | WYSKMSYNGHTKQR-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|