C23H47N3O — CID 5458666
(E)-N-[3-[4-(dimethylamino)butyl-methylamino]propyl]-3-methyldodec-2-enamide (PubChem CID 5458666) has the molecular formula C23H47N3O and a molecular weight of 381.65 g/mol. Its IUPAC name is (E)-N-[3-[4-(dimethylamino)butyl-methylamino]propyl]-3-methyldodec-2-enamide.
| Compound Name | (E)-N-[3-[4-(dimethylamino)butyl-methylamino]propyl]-3-methyldodec-2-enamide |
|---|---|
| PubChem CID | 5458666 |
| Molecular Formula | C23H47N3O |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.37 |
| IUPAC Name | (E)-N-[3-[4-(dimethylamino)butyl-methylamino]propyl]-3-methyldodec-2-enamide |
| SMILES | CCCCCCCCC/C(C)=C/C(=O)NCCCN(C)CCCCN(C)C |
| InChI | InChI=1S/C23H47N3O/c1-6-7-8-9-10-11-12-16-22(2)21-23(27)24-17-15-20-26(5)19-14-13-18-25(3)4/h21H,6-20H2,1-5H3,(H,24,27)/b22-21+ |
| InChIKey | AOZXJRMZZAIGRE-QURGRASLSA-N |
| XLogP | 4.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|