C20H27Cl2NO2 — CID 141279673
tert-butyl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-ethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 141279673) has the molecular formula C20H27Cl2NO2 and a molecular weight of 384.35 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-ethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-ethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 141279673 |
| Molecular Formula | C20H27Cl2NO2 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | tert-butyl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-ethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CCC1C[C@@H]2CN(C(=O)OC(C)(C)C)C[C@]2(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H27Cl2NO2/c1-5-13-8-15-11-23(18(24)25-19(2,3)4)12-20(15,10-13)14-6-7-16(21)17(22)9-14/h6-7,9,13,15H,5,8,10-12H2,1-4H3/t13?,15-,20+/m1/s1 |
| InChIKey | RPKVXZHPFPIRPU-LTWKLWEGSA-N |
| XLogP | 5.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |