C14H13Cl2F2NO2 — CID 141279668
(3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 141279668) has the molecular formula C14H13Cl2F2NO2 and a molecular weight of 336.17 g/mol. Its IUPAC name is (3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 141279668 |
| Molecular Formula | C14H13Cl2F2NO2 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-3,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)N1C[C@H]2CC(F)(F)C[C@@]2(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H13Cl2F2NO2/c15-10-2-1-8(3-11(10)16)13-6-14(17,18)4-9(13)5-19(7-13)12(20)21/h1-3,9H,4-7H2,(H,20,21)/t9-,13+/m1/s1 |
| InChIKey | YYKZEHVJBRKGLQ-RNCFNFMXSA-N |
| XLogP | 4.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |