C18H21Cl2NO2 — CID 68852014
1-tert-butyl-6-(3,4-dichlorophenyl)-6-ethenyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid (PubChem CID 68852014) has the molecular formula C18H21Cl2NO2 and a molecular weight of 354.28 g/mol. Its IUPAC name is 1-tert-butyl-6-(3,4-dichlorophenyl)-6-ethenyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid.
| Compound Name | 1-tert-butyl-6-(3,4-dichlorophenyl)-6-ethenyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
|---|---|
| PubChem CID | 68852014 |
| Molecular Formula | C18H21Cl2NO2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-tert-butyl-6-(3,4-dichlorophenyl)-6-ethenyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| SMILES | C=CC1(c2ccc(Cl)c(Cl)c2)C2CN(C(=O)O)CC21C(C)(C)C |
| InChI | InChI=1S/C18H21Cl2NO2/c1-5-17(11-6-7-12(19)13(20)8-11)14-9-21(15(22)23)10-18(14,17)16(2,3)4/h5-8,14H,1,9-10H2,2-4H3,(H,22,23) |
| InChIKey | OGFTYGZPNLEDTF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|