C17H21F3O4S — CID 141282861
4-[3-[2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane (PubChem CID 141282861) has the molecular formula C17H21F3O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is 4-[3-[2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane.
| Compound Name | 4-[3-[2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane |
|---|---|
| PubChem CID | 141282861 |
| Molecular Formula | C17H21F3O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-[3-[2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)C1CCC(OC2CCOCC2)C1 |
| InChI | InChI=1S/C17H21F3O4S/c18-17(19,20)15-3-1-2-4-16(15)25(21,22)14-6-5-13(11-14)24-12-7-9-23-10-8-12/h1-4,12-14H,5-11H2 |
| InChIKey | PRAFAGATARZVMJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |