C16H19F3O3S — CID 91115809
1-(3-cyclobutyloxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene (PubChem CID 91115809) has the molecular formula C16H19F3O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-(3-cyclobutyloxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene.
| Compound Name | 1-(3-cyclobutyloxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 91115809 |
| Molecular Formula | C16H19F3O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-(3-cyclobutyloxycyclopentyl)sulfonyl-2-(trifluoromethyl)benzene |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)C1CCC(OC2CCC2)C1 |
| InChI | InChI=1S/C16H19F3O3S/c17-16(18,19)14-6-1-2-7-15(14)23(20,21)13-9-8-12(10-13)22-11-4-3-5-11/h1-2,6-7,11-13H,3-5,8-10H2 |
| InChIKey | BQJUMYVSWHPBLZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |