C16H19N5O3S — CID 141283713
2-[(4-methoxyphenyl)methylsulfonyl]-N,N,9-trimethylpurin-6-amine (PubChem CID 141283713) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylsulfonyl]-N,N,9-trimethylpurin-6-amine.
| Compound Name | 2-[(4-methoxyphenyl)methylsulfonyl]-N,N,9-trimethylpurin-6-amine |
|---|---|
| PubChem CID | 141283713 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylsulfonyl]-N,N,9-trimethylpurin-6-amine |
| SMILES | COc1ccc(CS(=O)(=O)c2nc(N(C)C)c3ncn(C)c3n2)cc1 |
| InChI | InChI=1S/C16H19N5O3S/c1-20(2)14-13-15(21(3)10-17-13)19-16(18-14)25(22,23)9-11-5-7-12(24-4)8-6-11/h5-8,10H,9H2,1-4H3 |
| InChIKey | ZEMCJURTWHDLGE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |