C15H17N3O4 — CID 141283919
(4-nitrophenyl) N-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-5-ylmethyl)carbamate (PubChem CID 141283919) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is (4-nitrophenyl) N-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-5-ylmethyl)carbamate.
| Compound Name | (4-nitrophenyl) N-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-5-ylmethyl)carbamate |
|---|---|
| PubChem CID | 141283919 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (4-nitrophenyl) N-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-5-ylmethyl)carbamate |
| SMILES | O=C(NCC1CC2=C(CNC2)C1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N3O4/c19-15(22-14-3-1-13(2-4-14)18(20)21)17-7-10-5-11-8-16-9-12(11)6-10/h1-4,10,16H,5-9H2,(H,17,19) |
| InChIKey | LQLHLANOJLOKQO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|