C6H12Br2O6 — CID 141286273
3,4-dibromohexane-1,1,1,2,2,3-hexol (PubChem CID 141286273) has the molecular formula C6H12Br2O6 and a molecular weight of 339.96 g/mol. Its IUPAC name is 3,4-dibromohexane-1,1,1,2,2,3-hexol.
| Compound Name | 3,4-dibromohexane-1,1,1,2,2,3-hexol |
|---|---|
| PubChem CID | 141286273 |
| Molecular Formula | C6H12Br2O6 |
| Molecular Weight | 339.96 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | 3,4-dibromohexane-1,1,1,2,2,3-hexol |
| SMILES | CCC(Br)C(O)(Br)C(O)(O)C(O)(O)O |
| InChI | InChI=1S/C6H12Br2O6/c1-2-3(7)4(8,9)5(10,11)6(12,13)14/h3,9-14H,2H2,1H3 |
| InChIKey | KKFBDSYIMVXTSZ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.96 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|