C32H20N2O4S4 — CID 141288095
3,8-bis[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-1,10-phenanthroline (PubChem CID 141288095) has the molecular formula C32H20N2O4S4 and a molecular weight of 624.79 g/mol. Its IUPAC name is 3,8-bis[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-1,10-phenanthroline.
| Compound Name | 3,8-bis[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 141288095 |
| Molecular Formula | C32H20N2O4S4 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.03 |
| IUPAC Name | 3,8-bis[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-1,10-phenanthroline |
| SMILES | c1nc2c(ccc3cc(-c4ccc(-c5scc6c5OCCO6)s4)cnc32)cc1-c1ccc(-c2scc3c2OCCO3)s1 |
| InChI | InChI=1S/C32H20N2O4S4/c1-2-18-12-20(24-4-6-26(42-24)32-30-22(16-40-32)36-8-10-38-30)14-34-28(18)27-17(1)11-19(13-33-27)23-3-5-25(41-23)31-29-21(15-39-31)35-7-9-37-29/h1-6,11-16H,7-10H2 |
| InChIKey | LKLFFNRBIBPUTR-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|