C21H21Cl3N4 — CID 141292342
4-(3,4-dichlorophenyl)-7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,3,4-tetrahydroisoquinoline;hydrochloride (PubChem CID 141292342) has the molecular formula C21H21Cl3N4 and a molecular weight of 435.79 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,3,4-tetrahydroisoquinoline;hydrochloride.
| Compound Name | 4-(3,4-dichlorophenyl)-7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 141292342 |
| Molecular Formula | C21H21Cl3N4 |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| SMILES | Cl.Clc1ccc(C2CNCc3cc(C4CCc5ncnn5C4)ccc32)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N4.ClH/c22-19-5-2-14(8-20(19)23)18-10-24-9-16-7-13(1-4-17(16)18)15-3-6-21-25-12-26-27(21)11-15;/h1-2,4-5,7-8,12,15,18,24H,3,6,9-11H2;1H |
| InChIKey | BAOFMOLSNITLEE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |