C22H27Cl2N3O — CID 15982168
(4S)-4-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,3,4-tetrahydro-2,6-naphthyridine (PubChem CID 15982168) has the molecular formula C22H27Cl2N3O and a molecular weight of 420.38 g/mol. Its IUPAC name is (4S)-4-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,3,4-tetrahydro-2,6-naphthyridine.
| Compound Name | (4S)-4-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,3,4-tetrahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 15982168 |
| Molecular Formula | C22H27Cl2N3O |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (4S)-4-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,3,4-tetrahydro-2,6-naphthyridine |
| SMILES | Clc1ccc([C@@H]2CNCc3cc(OCCCN4CCCCC4)ncc32)cc1Cl |
| InChI | InChI=1S/C22H27Cl2N3O/c23-20-6-5-16(11-21(20)24)18-14-25-13-17-12-22(26-15-19(17)18)28-10-4-9-27-7-2-1-3-8-27/h5-6,11-12,15,18,25H,1-4,7-10,13-14H2/t18-/m0/s1 |
| InChIKey | RTXNVJXREKUAHX-SFHVURJKSA-N |
| XLogP | 4.88 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|