C25H27N3O4 — CID 141295385
7-[[[5-(3-hydroxypentan-3-yl)-1H-imidazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one (PubChem CID 141295385) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 7-[[[5-(3-hydroxypentan-3-yl)-1H-imidazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one.
| Compound Name | 7-[[[5-(3-hydroxypentan-3-yl)-1H-imidazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 141295385 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 7-[[[5-(3-hydroxypentan-3-yl)-1H-imidazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one |
| SMILES | CCC(O)(CC)c1cnc(NCc2ccc3c(-c4ccc(OC)cc4)cc(=O)oc3c2)[nH]1 |
| InChI | InChI=1S/C25H27N3O4/c1-4-25(30,5-2)22-15-27-24(28-22)26-14-16-6-11-19-20(13-23(29)32-21(19)12-16)17-7-9-18(31-3)10-8-17/h6-13,15,30H,4-5,14H2,1-3H3,(H2,26,27,28) |
| InChIKey | CCWQOCPQFRGPGB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|