C21H18FN3O4 — CID 143782542
4-(4-fluorophenyl)-7-[[[5-[(1S)-1-hydroxypropyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one (PubChem CID 143782542) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-7-[[[5-[(1S)-1-hydroxypropyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one.
| Compound Name | 4-(4-fluorophenyl)-7-[[[5-[(1S)-1-hydroxypropyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 143782542 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-(4-fluorophenyl)-7-[[[5-[(1S)-1-hydroxypropyl]-1,3,4-oxadiazol-2-yl]amino]methyl]chromen-2-one |
| SMILES | CC[C@H](O)c1nnc(NCc2ccc3c(-c4ccc(F)cc4)cc(=O)oc3c2)o1 |
| InChI | InChI=1S/C21H18FN3O4/c1-2-17(26)20-24-25-21(29-20)23-11-12-3-8-15-16(10-19(27)28-18(15)9-12)13-4-6-14(22)7-5-13/h3-10,17,26H,2,11H2,1H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | NEAYROAAVAVMQC-KRWDZBQOSA-N |
| XLogP | 4.04 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|