C22H18FNO5S2 — CID 174594136
(5-butan-2-yl-1,3-thiazol-2-yl) 4-(4-fluorophenyl)-2-oxochromene-7-sulfonate (PubChem CID 174594136) has the molecular formula C22H18FNO5S2 and a molecular weight of 459.52 g/mol. Its IUPAC name is (5-butan-2-yl-1,3-thiazol-2-yl) 4-(4-fluorophenyl)-2-oxochromene-7-sulfonate.
| Compound Name | (5-butan-2-yl-1,3-thiazol-2-yl) 4-(4-fluorophenyl)-2-oxochromene-7-sulfonate |
|---|---|
| PubChem CID | 174594136 |
| Molecular Formula | C22H18FNO5S2 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (5-butan-2-yl-1,3-thiazol-2-yl) 4-(4-fluorophenyl)-2-oxochromene-7-sulfonate |
| SMILES | CCC(C)c1cnc(OS(=O)(=O)c2ccc3c(-c4ccc(F)cc4)cc(=O)oc3c2)s1 |
| InChI | InChI=1S/C22H18FNO5S2/c1-3-13(2)20-12-24-22(30-20)29-31(26,27)16-8-9-17-18(11-21(25)28-19(17)10-16)14-4-6-15(23)7-5-14/h4-13H,3H2,1-2H3 |
| InChIKey | ASSMEOBIYBCNMF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|