C31H20FNO3S2 — CID 87463439
4-(4-fluorophenyl)-7-[[5-[hydroxy(diphenyl)methyl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one (PubChem CID 87463439) has the molecular formula C31H20FNO3S2 and a molecular weight of 537.64 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-7-[[5-[hydroxy(diphenyl)methyl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one.
| Compound Name | 4-(4-fluorophenyl)-7-[[5-[hydroxy(diphenyl)methyl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one |
|---|---|
| PubChem CID | 87463439 |
| Molecular Formula | C31H20FNO3S2 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 4-(4-fluorophenyl)-7-[[5-[hydroxy(diphenyl)methyl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one |
| SMILES | O=c1cc(-c2ccc(F)cc2)c2ccc(Sc3ncc(C(O)(c4ccccc4)c4ccccc4)s3)cc2o1 |
| InChI | InChI=1S/C31H20FNO3S2/c32-23-13-11-20(12-14-23)26-18-29(34)36-27-17-24(15-16-25(26)27)37-30-33-19-28(38-30)31(35,21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-19,35H |
| InChIKey | FDDKHTHLBQYDJL-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|