C21H11F6NO3S2 — CID 11306654
7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-4-phenylchromen-2-one (PubChem CID 11306654) has the molecular formula C21H11F6NO3S2 and a molecular weight of 503.45 g/mol. Its IUPAC name is 7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-4-phenylchromen-2-one.
| Compound Name | 7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 11306654 |
| Molecular Formula | C21H11F6NO3S2 |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | 7-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]-4-phenylchromen-2-one |
| SMILES | O=c1cc(-c2ccccc2)c2ccc(Sc3ncc(C(O)(C(F)(F)F)C(F)(F)F)s3)cc2o1 |
| InChI | InChI=1S/C21H11F6NO3S2/c22-20(23,24)19(30,21(25,26)27)16-10-28-18(33-16)32-12-6-7-13-14(11-4-2-1-3-5-11)9-17(29)31-15(13)8-12/h1-10,30H |
| InChIKey | CIPKUCYTIKOXLO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|