C24H25N3O5 — CID 11856709
7-[[[5-(3-hydroxypentan-3-yl)-1,3,4-oxadiazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one (PubChem CID 11856709) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 7-[[[5-(3-hydroxypentan-3-yl)-1,3,4-oxadiazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one.
| Compound Name | 7-[[[5-(3-hydroxypentan-3-yl)-1,3,4-oxadiazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 11856709 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 7-[[[5-(3-hydroxypentan-3-yl)-1,3,4-oxadiazol-2-yl]amino]methyl]-4-(4-methoxyphenyl)chromen-2-one |
| SMILES | CCC(O)(CC)c1nnc(NCc2ccc3c(-c4ccc(OC)cc4)cc(=O)oc3c2)o1 |
| InChI | InChI=1S/C24H25N3O5/c1-4-24(29,5-2)22-26-27-23(32-22)25-14-15-6-11-18-19(13-21(28)31-20(18)12-15)16-7-9-17(30-3)10-8-16/h6-13,29H,4-5,14H2,1-3H3,(H,25,27) |
| InChIKey | KHDBGWSHIGDQKO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|