C12H8F3IN2 — CID 141300072
5-iodo-3-methyl-N-(2,3,4-trifluorophenyl)pyridin-2-amine (PubChem CID 141300072) has the molecular formula C12H8F3IN2 and a molecular weight of 364.11 g/mol. Its IUPAC name is 5-iodo-3-methyl-N-(2,3,4-trifluorophenyl)pyridin-2-amine.
| Compound Name | 5-iodo-3-methyl-N-(2,3,4-trifluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 141300072 |
| Molecular Formula | C12H8F3IN2 |
| Molecular Weight | 364.11 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 5-iodo-3-methyl-N-(2,3,4-trifluorophenyl)pyridin-2-amine |
| SMILES | Cc1cc(I)cnc1Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H8F3IN2/c1-6-4-7(16)5-17-12(6)18-9-3-2-8(13)10(14)11(9)15/h2-5H,1H3,(H,17,18) |
| InChIKey | NOJBZICPAZAXJG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.11 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|