C21H28BrNO4 — CID 141300219
tert-butyl 4-[2-[3-bromo-5-(2-methoxyethoxy)phenyl]ethenylidene]piperidine-1-carboxylate (PubChem CID 141300219) has the molecular formula C21H28BrNO4 and a molecular weight of 438.36 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-bromo-5-(2-methoxyethoxy)phenyl]ethenylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-bromo-5-(2-methoxyethoxy)phenyl]ethenylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141300219 |
| Molecular Formula | C21H28BrNO4 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | tert-butyl 4-[2-[3-bromo-5-(2-methoxyethoxy)phenyl]ethenylidene]piperidine-1-carboxylate |
| SMILES | COCCOc1cc(Br)cc(C=C=C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H28BrNO4/c1-21(2,3)27-20(24)23-9-7-16(8-10-23)5-6-17-13-18(22)15-19(14-17)26-12-11-25-4/h6,13-15H,7-12H2,1-4H3 |
| InChIKey | QGWVHEVCWFCONE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|