C9H15N3O — CID 141303686
N-[2-(4,5-dihydroimidazol-1-yl)ethyl]-2-methylprop-2-enamide (PubChem CID 141303686) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is N-[2-(4,5-dihydroimidazol-1-yl)ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-(4,5-dihydroimidazol-1-yl)ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 141303686 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-[2-(4,5-dihydroimidazol-1-yl)ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCN1C=NCC1 |
| InChI | InChI=1S/C9H15N3O/c1-8(2)9(13)11-4-6-12-5-3-10-7-12/h7H,1,3-6H2,2H3,(H,11,13) |
| InChIKey | FBYCKPRVIKHHGS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|