5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid

C9H10O4 — CID 141310686

IUPAC5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid
SMILESO=C1OC2CC3(C(=O)O)CC1C2C3
InChIInChI=1S/C9H10O4/c10-7-5-2-9(8(11)12)1-4(5)6(3-9)13-7/h4-6H,1-3H2,(H,11,12)
InChIKeyMNDQXIOFIIRXBO-UHFFFAOYSA-N
MW182.17 g/mol
LogP0.41
Rot. Bonds1

About 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid

5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid (PubChem CID 141310686) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid.

Molecular Properties

Compound Name5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid
PubChem CID141310686
Molecular FormulaC9H10O4
Molecular Weight182.17 g/mol
Exact Mass182.06
IUPAC Name5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid
SMILESO=C1OC2CC3(C(=O)O)CC1C2C3
InChIInChI=1S/C9H10O4/c10-7-5-2-9(8(11)12)1-4(5)6(3-9)13-7/h4-6H,1-3H2,(H,11,12)
InChIKeyMNDQXIOFIIRXBO-UHFFFAOYSA-N
XLogP0.41
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.17
LogP ≤ 50.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid?
The IUPAC name of 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid (CID 141310686) is 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid.
What is the SMILES notation for 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid?
The canonical SMILES for 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid is O=C1OC2CC3(C(=O)O)CC1C2C3.
What is the InChIKey of 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid?
The InChIKey is MNDQXIOFIIRXBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c10-7-5-2-9(8(11)12)1-4(5)6(3-9)13-7/h4-6H,1-3H2,(H,11,12).
What are the key properties of 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid?
5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid has a molecular weight of 182.17 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-1-carboxylic acid is sourced from PubChem (CID 141310686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).