C20H27F3N4O — CID 141317151
[(2R)-4-cyclobutylpiperazin-2-yl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 141317151) has the molecular formula C20H27F3N4O and a molecular weight of 396.46 g/mol. Its IUPAC name is [(2R)-4-cyclobutylpiperazin-2-yl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [(2R)-4-cyclobutylpiperazin-2-yl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 141317151 |
| Molecular Formula | C20H27F3N4O |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | [(2R)-4-cyclobutylpiperazin-2-yl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C([C@H]1CN(C2CCC2)CCN1)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H27F3N4O/c21-20(22,23)15-4-6-17(7-5-15)25-10-12-26(13-11-25)19(28)18-14-27(9-8-24-18)16-2-1-3-16/h4-7,16,18,24H,1-3,8-14H2/t18-/m1/s1 |
| InChIKey | SGUGJTWNVAGBIF-GOSISDBHSA-N |
| XLogP | 2.18 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |