C17H14N4 — CID 141318395
2-pyridin-2-yl-3,5-dihydrophenazin-1-amine (PubChem CID 141318395) has the molecular formula C17H14N4 and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-pyridin-2-yl-3,5-dihydrophenazin-1-amine.
| Compound Name | 2-pyridin-2-yl-3,5-dihydrophenazin-1-amine |
|---|---|
| PubChem CID | 141318395 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-pyridin-2-yl-3,5-dihydrophenazin-1-amine |
| SMILES | NC1=C(c2ccccn2)CC=C2Nc3ccccc3N=C21 |
| InChI | InChI=1S/C17H14N4/c18-16-11(12-5-3-4-10-19-12)8-9-15-17(16)21-14-7-2-1-6-13(14)20-15/h1-7,9-10,20H,8,18H2 |
| InChIKey | ASPWVYOHCWDZIZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |