C40H57N3O7S — CID 141320160
benzyl (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfonylamino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 141320160) has the molecular formula C40H57N3O7S and a molecular weight of 723.98 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfonylamino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfonylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 141320160 |
| Molecular Formula | C40H57N3O7S |
| Molecular Weight | 723.98 g/mol |
| Exact Mass | 723.39 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfonylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](NC(=O)[C@H](CC1CCCCC1)S(=O)(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C40H57N3O7S/c1-39(2)32-22-23-40(39,3)35(26-32)42-36(44)34(25-29-15-7-4-8-16-29)51(47,48)43-33(37(45)49-27-30-17-9-5-10-18-30)21-13-14-24-41-38(46)50-28-31-19-11-6-12-20-31/h5-6,9-12,17-20,29,32-35,43H,4,7-8,13-16,21-28H2,1-3H3,(H,41,46)(H,42,44)/t32-,33-,34-,35-,40+/m0/s1 |
| InChIKey | JTDNGDWYPZBCEK-MDAOHFTBSA-N |
| XLogP | 6.78 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.98 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|