C32H48N2O7S — CID 10698897
tert-butyl (9S)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxo-9-(phenylmethoxycarbonylamino)decanoate (PubChem CID 10698897) has the molecular formula C32H48N2O7S and a molecular weight of 604.81 g/mol. Its IUPAC name is tert-butyl (9S)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxo-9-(phenylmethoxycarbonylamino)decanoate.
| Compound Name | tert-butyl (9S)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxo-9-(phenylmethoxycarbonylamino)decanoate |
|---|---|
| PubChem CID | 10698897 |
| Molecular Formula | C32H48N2O7S |
| Molecular Weight | 604.81 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | tert-butyl (9S)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxo-9-(phenylmethoxycarbonylamino)decanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C32H48N2O7S/c1-30(2,3)41-27(35)17-13-8-6-7-12-16-25(33-29(37)40-21-23-14-10-9-11-15-23)28(36)34-26-20-24-18-19-32(26,31(24,4)5)22-42(34,38)39/h9-11,14-15,24-26H,6-8,12-13,16-22H2,1-5H3,(H,33,37)/t24-,25+,26-,32-/m1/s1 |
| InChIKey | FTDNIASYTWVWSI-VUKRRIEASA-N |
| XLogP | 5.72 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.81 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|