C31H46N2O7S — CID 10745979
tert-butyl (8S)-9-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-9-oxo-8-(phenylmethoxycarbonylamino)nonanoate (PubChem CID 10745979) has the molecular formula C31H46N2O7S and a molecular weight of 590.78 g/mol. Its IUPAC name is tert-butyl (8S)-9-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-9-oxo-8-(phenylmethoxycarbonylamino)nonanoate.
| Compound Name | tert-butyl (8S)-9-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-9-oxo-8-(phenylmethoxycarbonylamino)nonanoate |
|---|---|
| PubChem CID | 10745979 |
| Molecular Formula | C31H46N2O7S |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | tert-butyl (8S)-9-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-9-oxo-8-(phenylmethoxycarbonylamino)nonanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C31H46N2O7S/c1-29(2,3)40-26(34)16-12-7-6-11-15-24(32-28(36)39-20-22-13-9-8-10-14-22)27(35)33-25-19-23-17-18-31(25,30(23,4)5)21-41(33,37)38/h8-10,13-14,23-25H,6-7,11-12,15-21H2,1-5H3,(H,32,36)/t23-,24+,25-,31-/m1/s1 |
| InChIKey | JLXUUNXNKHUZKW-XDAUYTPDSA-N |
| XLogP | 5.33 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|